C28H30F2N2O7 — CID 139562918
[(1R,2S)-1-(2,5-difluorophenoxy)-1-phenylpropan-2-yl] (2S)-2-[[(2E,4E)-3-acetyloxy-4-methoxy-2-(methylideneamino)hexa-2,4-dienoyl]amino]propanoate (PubChem CID 139562918) has the molecular formula C28H30F2N2O7 and a molecular weight of 544.55 g/mol. Its IUPAC name is [(1R,2S)-1-(2,5-difluorophenoxy)-1-phenylpropan-2-yl] (2S)-2-[[(2E,4E)-3-acetyloxy-4-methoxy-2-(methylideneamino)hexa-2,4-dienoyl]amino]propanoate.
| Compound Name | [(1R,2S)-1-(2,5-difluorophenoxy)-1-phenylpropan-2-yl] (2S)-2-[[(2E,4E)-3-acetyloxy-4-methoxy-2-(methylideneamino)hexa-2,4-dienoyl]amino]propanoate |
|---|---|
| PubChem CID | 139562918 |
| Molecular Formula | C28H30F2N2O7 |
| Molecular Weight | 544.55 g/mol |
| Exact Mass | 544.20 |
| IUPAC Name | [(1R,2S)-1-(2,5-difluorophenoxy)-1-phenylpropan-2-yl] (2S)-2-[[(2E,4E)-3-acetyloxy-4-methoxy-2-(methylideneamino)hexa-2,4-dienoyl]amino]propanoate |
| SMILES | C=N/C(C(=O)N[C@@H](C)C(=O)O[C@@H](C)[C@H](Oc1cc(F)ccc1F)c1ccccc1)=C(OC(C)=O)\C(=C/C)OC |
| InChI | InChI=1S/C28H30F2N2O7/c1-7-22(36-6)26(38-18(4)33)24(31-5)27(34)32-16(2)28(35)37-17(3)25(19-11-9-8-10-12-19)39-23-15-20(29)13-14-21(23)30/h7-17,25H,5H2,1-4,6H3,(H,32,34)/b22-7+,26-24+/t16-,17-,25-/m0/s1 |
| InChIKey | GETQGLUCYBLLFG-AASNCREESA-N |
| XLogP | 4.55 |
| TPSA | 112.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.55 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|