C31H35F3N2O7 — CID 139562908
[(1R,2S)-1-phenyl-1-[4-(trifluoromethyl)phenoxy]propan-2-yl] (2S)-2-[[(2E,4E)-3-acetyloxy-4-methoxy-2-(methylideneamino)hexa-2,4-dienoyl]amino]-3-methylbutanoate (PubChem CID 139562908) has the molecular formula C31H35F3N2O7 and a molecular weight of 604.62 g/mol. Its IUPAC name is [(1R,2S)-1-phenyl-1-[4-(trifluoromethyl)phenoxy]propan-2-yl] (2S)-2-[[(2E,4E)-3-acetyloxy-4-methoxy-2-(methylideneamino)hexa-2,4-dienoyl]amino]-3-methylbutanoate.
| Compound Name | [(1R,2S)-1-phenyl-1-[4-(trifluoromethyl)phenoxy]propan-2-yl] (2S)-2-[[(2E,4E)-3-acetyloxy-4-methoxy-2-(methylideneamino)hexa-2,4-dienoyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 139562908 |
| Molecular Formula | C31H35F3N2O7 |
| Molecular Weight | 604.62 g/mol |
| Exact Mass | 604.24 |
| IUPAC Name | [(1R,2S)-1-phenyl-1-[4-(trifluoromethyl)phenoxy]propan-2-yl] (2S)-2-[[(2E,4E)-3-acetyloxy-4-methoxy-2-(methylideneamino)hexa-2,4-dienoyl]amino]-3-methylbutanoate |
| SMILES | C=N/C(C(=O)N[C@H](C(=O)O[C@@H](C)[C@H](Oc1ccc(C(F)(F)F)cc1)c1ccccc1)C(C)C)=C(OC(C)=O)\C(=C/C)OC |
| InChI | InChI=1S/C31H35F3N2O7/c1-8-24(40-7)28(42-20(5)37)26(35-6)29(38)36-25(18(2)3)30(39)41-19(4)27(21-12-10-9-11-13-21)43-23-16-14-22(15-17-23)31(32,33)34/h8-19,25,27H,6H2,1-5,7H3,(H,36,38)/b24-8+,28-26+/t19-,25-,27-/m0/s1 |
| InChIKey | RPYSCYNEFXDVBX-KGZCAOBPSA-N |
| XLogP | 5.92 |
| TPSA | 112.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.62 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|