C24H32N2O6 — CID 139472961
[(2S,3S)-3-(2-methylphenyl)butan-2-yl] (2S)-2-[[(2E,4E)-3-acetyloxy-4-methoxy-2-(methylideneamino)hexa-2,4-dienoyl]amino]propanoate (PubChem CID 139472961) has the molecular formula C24H32N2O6 and a molecular weight of 444.53 g/mol. Its IUPAC name is [(2S,3S)-3-(2-methylphenyl)butan-2-yl] (2S)-2-[[(2E,4E)-3-acetyloxy-4-methoxy-2-(methylideneamino)hexa-2,4-dienoyl]amino]propanoate.
| Compound Name | [(2S,3S)-3-(2-methylphenyl)butan-2-yl] (2S)-2-[[(2E,4E)-3-acetyloxy-4-methoxy-2-(methylideneamino)hexa-2,4-dienoyl]amino]propanoate |
|---|---|
| PubChem CID | 139472961 |
| Molecular Formula | C24H32N2O6 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | [(2S,3S)-3-(2-methylphenyl)butan-2-yl] (2S)-2-[[(2E,4E)-3-acetyloxy-4-methoxy-2-(methylideneamino)hexa-2,4-dienoyl]amino]propanoate |
| SMILES | C=N/C(C(=O)N[C@@H](C)C(=O)O[C@@H](C)[C@@H](C)c1ccccc1C)=C(OC(C)=O)\C(=C/C)OC |
| InChI | InChI=1S/C24H32N2O6/c1-9-20(30-8)22(32-18(6)27)21(25-7)23(28)26-16(4)24(29)31-17(5)15(3)19-13-11-10-12-14(19)2/h9-13,15-17H,7H2,1-6,8H3,(H,26,28)/b20-9+,22-21+/t15-,16+,17+/m1/s1 |
| InChIKey | FNZYCKMFXJXQAU-KCSSECDBSA-N |
| XLogP | 3.56 |
| TPSA | 103.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|