C21H15F7OS — CID 139563028
1-(2,2,3,3-tetrafluoro-4H-thiochromen-6-yl)-4-[2-(trifluoromethyl)phenyl]pent-4-en-1-one (PubChem CID 139563028) has the molecular formula C21H15F7OS and a molecular weight of 448.40 g/mol. Its IUPAC name is 1-(2,2,3,3-tetrafluoro-4H-thiochromen-6-yl)-4-[2-(trifluoromethyl)phenyl]pent-4-en-1-one.
| Compound Name | 1-(2,2,3,3-tetrafluoro-4H-thiochromen-6-yl)-4-[2-(trifluoromethyl)phenyl]pent-4-en-1-one |
|---|---|
| PubChem CID | 139563028 |
| Molecular Formula | C21H15F7OS |
| Molecular Weight | 448.40 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | 1-(2,2,3,3-tetrafluoro-4H-thiochromen-6-yl)-4-[2-(trifluoromethyl)phenyl]pent-4-en-1-one |
| SMILES | C=C(CCC(=O)c1ccc2c(c1)CC(F)(F)C(F)(F)S2)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C21H15F7OS/c1-12(15-4-2-3-5-16(15)20(24,25)26)6-8-17(29)13-7-9-18-14(10-13)11-19(22,23)21(27,28)30-18/h2-5,7,9-10H,1,6,8,11H2 |
| InChIKey | FVUAZIUWZPUTDZ-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.40 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|