C18H12F4O4S — CID 162572612
1-(2-hydroxyphenyl)-4-(2,2,3,3-tetrafluoro-1,4-benzoxathiin-6-yl)butane-1,4-dione (PubChem CID 162572612) has the molecular formula C18H12F4O4S and a molecular weight of 400.35 g/mol. Its IUPAC name is 1-(2-hydroxyphenyl)-4-(2,2,3,3-tetrafluoro-1,4-benzoxathiin-6-yl)butane-1,4-dione.
| Compound Name | 1-(2-hydroxyphenyl)-4-(2,2,3,3-tetrafluoro-1,4-benzoxathiin-6-yl)butane-1,4-dione |
|---|---|
| PubChem CID | 162572612 |
| Molecular Formula | C18H12F4O4S |
| Molecular Weight | 400.35 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | 1-(2-hydroxyphenyl)-4-(2,2,3,3-tetrafluoro-1,4-benzoxathiin-6-yl)butane-1,4-dione |
| SMILES | O=C(CCC(=O)c1ccccc1O)c1ccc2c(c1)SC(F)(F)C(F)(F)O2 |
| InChI | InChI=1S/C18H12F4O4S/c19-17(20)18(21,22)27-16-9-10(5-8-15(16)26-17)12(23)6-7-14(25)11-3-1-2-4-13(11)24/h1-5,8-9,24H,6-7H2 |
| InChIKey | MPPQMBKFRZISJP-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.35 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|