C19H22ClF3N6O2 — CID 139564748
2-[3-[[1-(6-amino-5-chloropyrimidin-4-yl)-1-hydroxyethyl]amino]pyrrolidin-1-yl]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 139564748) has the molecular formula C19H22ClF3N6O2 and a molecular weight of 458.87 g/mol. Its IUPAC name is 2-[3-[[1-(6-amino-5-chloropyrimidin-4-yl)-1-hydroxyethyl]amino]pyrrolidin-1-yl]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[3-[[1-(6-amino-5-chloropyrimidin-4-yl)-1-hydroxyethyl]amino]pyrrolidin-1-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 139564748 |
| Molecular Formula | C19H22ClF3N6O2 |
| Molecular Weight | 458.87 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 2-[3-[[1-(6-amino-5-chloropyrimidin-4-yl)-1-hydroxyethyl]amino]pyrrolidin-1-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | CC(O)(NC1CCN(CC(=O)Nc2cccc(C(F)(F)F)c2)C1)c1ncnc(N)c1Cl |
| InChI | InChI=1S/C19H22ClF3N6O2/c1-18(31,16-15(20)17(24)26-10-25-16)28-13-5-6-29(8-13)9-14(30)27-12-4-2-3-11(7-12)19(21,22)23/h2-4,7,10,13,28,31H,5-6,8-9H2,1H3,(H,27,30)(H2,24,25,26) |
| InChIKey | CHMKHCGMROHVNQ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.87 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|