About prop-2-ynyl 2-[methyl(prop-2-enyl)amino]-2-oxoacetate
prop-2-ynyl 2-[methyl(prop-2-enyl)amino]-2-oxoacetate (PubChem CID 139567548) has the molecular formula C9H11NO3
and a molecular weight of 181.19 g/mol. Its IUPAC name is prop-2-ynyl 2-[methyl(prop-2-enyl)amino]-2-oxoacetate.
Molecular Properties
| Compound Name | prop-2-ynyl 2-[methyl(prop-2-enyl)amino]-2-oxoacetate |
| PubChem CID | 139567548 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | prop-2-ynyl 2-[methyl(prop-2-enyl)amino]-2-oxoacetate |
| SMILES | C#CCOC(=O)C(=O)N(C)CC=C |
| InChI | InChI=1S/C9H11NO3/c1-4-6-10(3)8(11)9(12)13-7-5-2/h2,4H,1,6-7H2,3H3 |
| InChIKey | RQSFEBNYCAGABO-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze prop-2-ynyl 2-[methyl(prop-2-enyl)amino]-2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-ynyl 2-[methyl(prop-2-enyl)amino]-2-oxoacetate?
The IUPAC name of prop-2-ynyl 2-[methyl(prop-2-enyl)amino]-2-oxoacetate (CID 139567548) is prop-2-ynyl 2-[methyl(prop-2-enyl)amino]-2-oxoacetate.
What is the SMILES notation for prop-2-ynyl 2-[methyl(prop-2-enyl)amino]-2-oxoacetate?
The canonical SMILES for prop-2-ynyl 2-[methyl(prop-2-enyl)amino]-2-oxoacetate is C#CCOC(=O)C(=O)N(C)CC=C.
What is the InChIKey of prop-2-ynyl 2-[methyl(prop-2-enyl)amino]-2-oxoacetate?
The InChIKey is RQSFEBNYCAGABO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO3/c1-4-6-10(3)8(11)9(12)13-7-5-2/h2,4H,1,6-7H2,3H3.
What are the key properties of prop-2-ynyl 2-[methyl(prop-2-enyl)amino]-2-oxoacetate?
prop-2-ynyl 2-[methyl(prop-2-enyl)amino]-2-oxoacetate has a molecular weight of 181.19 g/mol, XLogP of -0.19, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-ynyl 2-[methyl(prop-2-enyl)amino]-2-oxoacetate is sourced from PubChem (CID 139567548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).