C9H12F3NO3 — CID 139567785
2,3,3-trifluoroprop-2-enyl 2-(diethylamino)-2-oxoacetate (PubChem CID 139567785) has the molecular formula C9H12F3NO3 and a molecular weight of 239.19 g/mol. Its IUPAC name is 2,3,3-trifluoroprop-2-enyl 2-(diethylamino)-2-oxoacetate.
| Compound Name | 2,3,3-trifluoroprop-2-enyl 2-(diethylamino)-2-oxoacetate |
|---|---|
| PubChem CID | 139567785 |
| Molecular Formula | C9H12F3NO3 |
| Molecular Weight | 239.19 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 2,3,3-trifluoroprop-2-enyl 2-(diethylamino)-2-oxoacetate |
| SMILES | CCN(CC)C(=O)C(=O)OCC(F)=C(F)F |
| InChI | InChI=1S/C9H12F3NO3/c1-3-13(4-2)8(14)9(15)16-5-6(10)7(11)12/h3-5H2,1-2H3 |
| InChIKey | RDXKVUGGUVDHTQ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.19 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|