C21H25N3O2 — CID 139575800
(E)-N-[[4-(butylaminocarbamoyl)phenyl]methyl]-3-phenylprop-2-enamide (PubChem CID 139575800) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is (E)-N-[[4-(butylaminocarbamoyl)phenyl]methyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[[4-(butylaminocarbamoyl)phenyl]methyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 139575800 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | (E)-N-[[4-(butylaminocarbamoyl)phenyl]methyl]-3-phenylprop-2-enamide |
| SMILES | CCCCNNC(=O)c1ccc(CNC(=O)/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C21H25N3O2/c1-2-3-15-23-24-21(26)19-12-9-18(10-13-19)16-22-20(25)14-11-17-7-5-4-6-8-17/h4-14,23H,2-3,15-16H2,1H3,(H,22,25)(H,24,26)/b14-11+ |
| InChIKey | NUJQZBBINFCTIV-SDNWHVSQSA-N |
| XLogP | 3.05 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|