C19H28O5 — CID 139583260
[(2R,3R,4S)-2,4-dimethyl-5-oxooxolan-3-yl]methyl 2-[(1R,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetate (PubChem CID 139583260) has the molecular formula C19H28O5 and a molecular weight of 336.43 g/mol. Its IUPAC name is [(2R,3R,4S)-2,4-dimethyl-5-oxooxolan-3-yl]methyl 2-[(1R,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetate.
| Compound Name | [(2R,3R,4S)-2,4-dimethyl-5-oxooxolan-3-yl]methyl 2-[(1R,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetate |
|---|---|
| PubChem CID | 139583260 |
| Molecular Formula | C19H28O5 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | [(2R,3R,4S)-2,4-dimethyl-5-oxooxolan-3-yl]methyl 2-[(1R,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetate |
| SMILES | CC/C=C\C[C@H]1C(=O)CC[C@@H]1CC(=O)OC[C@H]1[C@H](C)C(=O)O[C@@H]1C |
| InChI | InChI=1S/C19H28O5/c1-4-5-6-7-15-14(8-9-17(15)20)10-18(21)23-11-16-12(2)19(22)24-13(16)3/h5-6,12-16H,4,7-11H2,1-3H3/b6-5-/t12-,13+,14+,15+,16-/m0/s1 |
| InChIKey | XUDSPOIZGCSHJD-MVALDTSZSA-N |
| XLogP | 3.07 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|