C15H18O5 — CID 139585080
5-[(Z)-4-hydroxy-3-methylbut-2-enoxy]-7-methoxy-6-methyl-3H-2-benzofuran-1-one (PubChem CID 139585080) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is 5-[(Z)-4-hydroxy-3-methylbut-2-enoxy]-7-methoxy-6-methyl-3H-2-benzofuran-1-one.
| Compound Name | 5-[(Z)-4-hydroxy-3-methylbut-2-enoxy]-7-methoxy-6-methyl-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 139585080 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 5-[(Z)-4-hydroxy-3-methylbut-2-enoxy]-7-methoxy-6-methyl-3H-2-benzofuran-1-one |
| SMILES | COc1c(C)c(OC/C=C(/C)CO)cc2c1C(=O)OC2 |
| InChI | InChI=1S/C15H18O5/c1-9(7-16)4-5-19-12-6-11-8-20-15(17)13(11)14(18-3)10(12)2/h4,6,16H,5,7-8H2,1-3H3/b9-4- |
| InChIKey | AKQXDTZFGGTDHR-WTKPLQERSA-N |
| XLogP | 1.99 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|