C9H8O5 — CID 102295970
5,7-dihydroxy-6-methoxy-3H-2-benzofuran-1-one (PubChem CID 102295970) has the molecular formula C9H8O5 and a molecular weight of 196.16 g/mol. Its IUPAC name is 5,7-dihydroxy-6-methoxy-3H-2-benzofuran-1-one.
| Compound Name | 5,7-dihydroxy-6-methoxy-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 102295970 |
| Molecular Formula | C9H8O5 |
| Molecular Weight | 196.16 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | 5,7-dihydroxy-6-methoxy-3H-2-benzofuran-1-one |
| SMILES | COc1c(O)cc2c(c1O)C(=O)OC2 |
| InChI | InChI=1S/C9H8O5/c1-13-8-5(10)2-4-3-14-9(12)6(4)7(8)11/h2,10-11H,3H2,1H3 |
| InChIKey | OEQOYURKHBTFKQ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.16 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |