C21H30O5 — CID 139589367
(3R)-3-[(2R,3R)-2,3-dihydroxyoctyl]-7-hydroxy-4-(3-methylbut-2-enyl)-3H-2-benzofuran-1-one (PubChem CID 139589367) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is (3R)-3-[(2R,3R)-2,3-dihydroxyoctyl]-7-hydroxy-4-(3-methylbut-2-enyl)-3H-2-benzofuran-1-one.
| Compound Name | (3R)-3-[(2R,3R)-2,3-dihydroxyoctyl]-7-hydroxy-4-(3-methylbut-2-enyl)-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 139589367 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | (3R)-3-[(2R,3R)-2,3-dihydroxyoctyl]-7-hydroxy-4-(3-methylbut-2-enyl)-3H-2-benzofuran-1-one |
| SMILES | CCCCC[C@@H](O)[C@H](O)C[C@H]1OC(=O)c2c(O)ccc(CC=C(C)C)c21 |
| InChI | InChI=1S/C21H30O5/c1-4-5-6-7-15(22)17(24)12-18-19-14(9-8-13(2)3)10-11-16(23)20(19)21(25)26-18/h8,10-11,15,17-18,22-24H,4-7,9,12H2,1-3H3/t15-,17-,18-/m1/s1 |
| InChIKey | ZFTKJAWVCXVCCO-KBAYOESNSA-N |
| XLogP | 3.80 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|