C19H24O5 — CID 162968901
5,8-dihydroxy-4-methoxy-3-nona-1,3-dienyl-3,4-dihydroisochromen-1-one (PubChem CID 162968901) has the molecular formula C19H24O5 and a molecular weight of 332.40 g/mol. Its IUPAC name is 5,8-dihydroxy-4-methoxy-3-nona-1,3-dienyl-3,4-dihydroisochromen-1-one.
| Compound Name | 5,8-dihydroxy-4-methoxy-3-nona-1,3-dienyl-3,4-dihydroisochromen-1-one |
|---|---|
| PubChem CID | 162968901 |
| Molecular Formula | C19H24O5 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 5,8-dihydroxy-4-methoxy-3-nona-1,3-dienyl-3,4-dihydroisochromen-1-one |
| SMILES | CCCCCC=CC=CC1OC(=O)c2c(O)ccc(O)c2C1OC |
| InChI | InChI=1S/C19H24O5/c1-3-4-5-6-7-8-9-10-15-18(23-2)16-13(20)11-12-14(21)17(16)19(22)24-15/h7-12,15,18,20-21H,3-6H2,1-2H3 |
| InChIKey | MERZFCDASXJJEF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|