C21H26O6 — CID 139590275
(2R)-6-hydroxy-2-[(3E,7E)-9-hydroxy-4,8-dimethylnona-3,7-dienyl]-4-oxo-3H-chromene-2-carboxylic acid (PubChem CID 139590275) has the molecular formula C21H26O6 and a molecular weight of 374.43 g/mol. Its IUPAC name is (2R)-6-hydroxy-2-[(3E,7E)-9-hydroxy-4,8-dimethylnona-3,7-dienyl]-4-oxo-3H-chromene-2-carboxylic acid.
| Compound Name | (2R)-6-hydroxy-2-[(3E,7E)-9-hydroxy-4,8-dimethylnona-3,7-dienyl]-4-oxo-3H-chromene-2-carboxylic acid |
|---|---|
| PubChem CID | 139590275 |
| Molecular Formula | C21H26O6 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | (2R)-6-hydroxy-2-[(3E,7E)-9-hydroxy-4,8-dimethylnona-3,7-dienyl]-4-oxo-3H-chromene-2-carboxylic acid |
| SMILES | C/C(=C\CC/C(C)=C/CC[C@]1(C(=O)O)CC(=O)c2cc(O)ccc2O1)CO |
| InChI | InChI=1S/C21H26O6/c1-14(5-3-6-15(2)13-22)7-4-10-21(20(25)26)12-18(24)17-11-16(23)8-9-19(17)27-21/h6-9,11,22-23H,3-5,10,12-13H2,1-2H3,(H,25,26)/b14-7+,15-6+/t21-/m1/s1 |
| InChIKey | VLXRBLIWOFMVDW-YQERWRMHSA-N |
| XLogP | 3.63 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|