C28H41O2P — CID 70821602
2,7,8-trimethyl-6-phosphanyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3H-chromen-4-one (PubChem CID 70821602) has the molecular formula C28H41O2P and a molecular weight of 440.61 g/mol. Its IUPAC name is 2,7,8-trimethyl-6-phosphanyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3H-chromen-4-one.
| Compound Name | 2,7,8-trimethyl-6-phosphanyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3H-chromen-4-one |
|---|---|
| PubChem CID | 70821602 |
| Molecular Formula | C28H41O2P |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | 2,7,8-trimethyl-6-phosphanyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3H-chromen-4-one |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CCC1(C)CC(=O)c2cc(P)c(C)c(C)c2O1 |
| InChI | InChI=1S/C28H41O2P/c1-19(2)11-8-12-20(3)13-9-14-21(4)15-10-16-28(7)18-25(29)24-17-26(31)22(5)23(6)27(24)30-28/h11,13,15,17H,8-10,12,14,16,18,31H2,1-7H3/b20-13+,21-15+ |
| InChIKey | OJRMAPDPHUMMTK-RSKMIKRQSA-N |
| XLogP | 7.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|