C6H7NO3 — CID 139596636
1-hydroxy-2H-pyridine-5-carboxylic acid (PubChem CID 139596636) has the molecular formula C6H7NO3 and a molecular weight of 141.13 g/mol. Its IUPAC name is 1-hydroxy-2H-pyridine-5-carboxylic acid.
| Compound Name | 1-hydroxy-2H-pyridine-5-carboxylic acid |
|---|---|
| PubChem CID | 139596636 |
| Molecular Formula | C6H7NO3 |
| Molecular Weight | 141.13 g/mol |
| Exact Mass | 141.04 |
| IUPAC Name | 1-hydroxy-2H-pyridine-5-carboxylic acid |
| SMILES | O=C(O)C1=CN(O)CC=C1 |
| InChI | InChI=1S/C6H7NO3/c8-6(9)5-2-1-3-7(10)4-5/h1-2,4,10H,3H2,(H,8,9) |
| InChIKey | PODGEHLAMIJTCD-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.13 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |