C22H17Cl3O3 — CID 139600127
4-[bis[3-(chloromethyl)-4-hydroxyphenyl]methylidene]-2-(chloromethyl)cyclohexa-2,5-dien-1-one (PubChem CID 139600127) has the molecular formula C22H17Cl3O3 and a molecular weight of 435.73 g/mol. Its IUPAC name is 4-[bis[3-(chloromethyl)-4-hydroxyphenyl]methylidene]-2-(chloromethyl)cyclohexa-2,5-dien-1-one.
| Compound Name | 4-[bis[3-(chloromethyl)-4-hydroxyphenyl]methylidene]-2-(chloromethyl)cyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 139600127 |
| Molecular Formula | C22H17Cl3O3 |
| Molecular Weight | 435.73 g/mol |
| Exact Mass | 434.02 |
| IUPAC Name | 4-[bis[3-(chloromethyl)-4-hydroxyphenyl]methylidene]-2-(chloromethyl)cyclohexa-2,5-dien-1-one |
| SMILES | O=C1C=CC(=C(c2ccc(O)c(CCl)c2)c2ccc(O)c(CCl)c2)C=C1CCl |
| InChI | InChI=1S/C22H17Cl3O3/c23-10-16-7-13(1-4-19(16)26)22(14-2-5-20(27)17(8-14)11-24)15-3-6-21(28)18(9-15)12-25/h1-9,26-27H,10-12H2 |
| InChIKey | CAORLJDWPDJORR-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.73 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|