C19H14NaO3+ — CID 18940246
sodium 4-[bis(4-hydroxyphenyl)methylidene]cyclohexa-2,5-dien-1-one (PubChem CID 18940246) has the molecular formula C19H14NaO3+ and a molecular weight of 313.31 g/mol. Its IUPAC name is sodium 4-[bis(4-hydroxyphenyl)methylidene]cyclohexa-2,5-dien-1-one.
| Compound Name | sodium 4-[bis(4-hydroxyphenyl)methylidene]cyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 18940246 |
| Molecular Formula | C19H14NaO3+ |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | sodium 4-[bis(4-hydroxyphenyl)methylidene]cyclohexa-2,5-dien-1-one |
| SMILES | O=C1C=CC(=C(c2ccc(O)cc2)c2ccc(O)cc2)C=C1.[Na+] |
| InChI | InChI=1S/C19H14O3.Na/c20-16-7-1-13(2-8-16)19(14-3-9-17(21)10-4-14)15-5-11-18(22)12-6-15;/h1-12,20-21H;/q;+1 |
| InChIKey | YJTBSSKLFWSVDI-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |