C18H16O6 — CID 162301251
benzene-1,4-diol;cyclohexa-2,5-diene-1,4-dione;4-hydroxycyclohexa-2,4-dien-1-one (PubChem CID 162301251) has the molecular formula C18H16O6 and a molecular weight of 328.32 g/mol. Its IUPAC name is benzene-1,4-diol;cyclohexa-2,5-diene-1,4-dione;4-hydroxycyclohexa-2,4-dien-1-one.
| Compound Name | benzene-1,4-diol;cyclohexa-2,5-diene-1,4-dione;4-hydroxycyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 162301251 |
| Molecular Formula | C18H16O6 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | benzene-1,4-diol;cyclohexa-2,5-diene-1,4-dione;4-hydroxycyclohexa-2,4-dien-1-one |
| SMILES | O=C1C=CC(=O)C=C1.O=C1C=CC(O)=CC1.Oc1ccc(O)cc1 |
| InChI | InChI=1S/2C6H6O2.C6H4O2/c3*7-5-1-2-6(8)4-3-5/h1-3,7H,4H2;1-4,7-8H;1-4H |
| InChIKey | QKGXUQBADKQJAS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|