C19H14O4S — CID 71193519
(4Z)-4-[(3,4-dihydroxyphenyl)-(2-sulfanylphenyl)methylidene]-2-hydroxycyclohexa-2,5-dien-1-one (PubChem CID 71193519) has the molecular formula C19H14O4S and a molecular weight of 338.38 g/mol. Its IUPAC name is (4Z)-4-[(3,4-dihydroxyphenyl)-(2-sulfanylphenyl)methylidene]-2-hydroxycyclohexa-2,5-dien-1-one.
| Compound Name | (4Z)-4-[(3,4-dihydroxyphenyl)-(2-sulfanylphenyl)methylidene]-2-hydroxycyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 71193519 |
| Molecular Formula | C19H14O4S |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | (4Z)-4-[(3,4-dihydroxyphenyl)-(2-sulfanylphenyl)methylidene]-2-hydroxycyclohexa-2,5-dien-1-one |
| SMILES | O=C1C=C/C(=C(\c2ccc(O)c(O)c2)c2ccccc2S)C=C1O |
| InChI | InChI=1S/C19H14O4S/c20-14-7-5-11(9-16(14)22)19(13-3-1-2-4-18(13)24)12-6-8-15(21)17(23)10-12/h1-10,20,22-24H/b19-12- |
| InChIKey | NPJLCOFIGBNILO-UNOMPAQXSA-N |
| XLogP | 3.77 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|