C19H12O7S-2 — CID 119078164
2-hydroxy-4-[(3-oxido-4-oxocyclohexa-2,5-dien-1-ylidene)-(2-sulfophenyl)methyl]phenolate (PubChem CID 119078164) has the molecular formula C19H12O7S-2 and a molecular weight of 384.37 g/mol. Its IUPAC name is 2-hydroxy-4-[(3-oxido-4-oxocyclohexa-2,5-dien-1-ylidene)-(2-sulfophenyl)methyl]phenolate.
| Compound Name | 2-hydroxy-4-[(3-oxido-4-oxocyclohexa-2,5-dien-1-ylidene)-(2-sulfophenyl)methyl]phenolate |
|---|---|
| PubChem CID | 119078164 |
| Molecular Formula | C19H12O7S-2 |
| Molecular Weight | 384.37 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | 2-hydroxy-4-[(3-oxido-4-oxocyclohexa-2,5-dien-1-ylidene)-(2-sulfophenyl)methyl]phenolate |
| SMILES | O=C1C=CC(=C(c2ccc([O-])c(O)c2)c2ccccc2S(=O)(=O)O)C=C1[O-] |
| InChI | InChI=1S/C19H14O7S/c20-14-7-5-11(9-16(14)22)19(12-6-8-15(21)17(23)10-12)13-3-1-2-4-18(13)27(24,25)26/h1-10,20,22-23H,(H,24,25,26)/p-2 |
| InChIKey | HGPSVOAVAYJEIJ-UHFFFAOYSA-L |
| XLogP | 0.90 |
| TPSA | 137.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.37 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|