C20H8Br4Na2O10S2 — CID 131675765
disodium;2,3,4,5-tetrabromo-6-[(Z)-(4-oxido-3-sulfophenyl)-(4-oxo-3-sulfocyclohexa-2,5-dien-1-ylidene)methyl]benzoate (PubChem CID 131675765) has the molecular formula C20H8Br4Na2O10S2 and a molecular weight of 838.00 g/mol. Its IUPAC name is disodium;2,3,4,5-tetrabromo-6-[(Z)-(4-oxido-3-sulfophenyl)-(4-oxo-3-sulfocyclohexa-2,5-dien-1-ylidene)methyl]benzoate.
| Compound Name | disodium;2,3,4,5-tetrabromo-6-[(Z)-(4-oxido-3-sulfophenyl)-(4-oxo-3-sulfocyclohexa-2,5-dien-1-ylidene)methyl]benzoate |
|---|---|
| PubChem CID | 131675765 |
| Molecular Formula | C20H8Br4Na2O10S2 |
| Molecular Weight | 838.00 g/mol |
| Exact Mass | 833.61 |
| IUPAC Name | disodium;2,3,4,5-tetrabromo-6-[(Z)-(4-oxido-3-sulfophenyl)-(4-oxo-3-sulfocyclohexa-2,5-dien-1-ylidene)methyl]benzoate |
| SMILES | O=C1C=C/C(=C(\c2ccc([O-])c(S(=O)(=O)O)c2)c2c(Br)c(Br)c(Br)c(Br)c2C(=O)[O-])C=C1S(=O)(=O)O.[Na+].[Na+] |
| InChI | InChI=1S/C20H10Br4O10S2.2Na/c21-16-14(15(20(27)28)17(22)19(24)18(16)23)13(7-1-3-9(25)11(5-7)35(29,30)31)8-2-4-10(26)12(6-8)36(32,33)34;;/h1-6,25H,(H,27,28)(H,29,30,31)(H,32,33,34);;/q;2*+1/p-2/b13-8-;; |
| InChIKey | HXUITPQMHVLBNV-KEZMYAPCSA-L |
| XLogP | -2.86 |
| TPSA | 189.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.00 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|