C20H10Br4O10S2 — CID 66509204
2,3,4,5-tetrabromo-6-[(Z)-(4-hydroxy-3-sulfophenyl)-(4-oxo-3-sulfocyclohexa-2,5-dien-1-ylidene)methyl]benzoic acid (PubChem CID 66509204) has the molecular formula C20H10Br4O10S2 and a molecular weight of 794.04 g/mol. Its IUPAC name is 2,3,4,5-tetrabromo-6-[(Z)-(4-hydroxy-3-sulfophenyl)-(4-oxo-3-sulfocyclohexa-2,5-dien-1-ylidene)methyl]benzoic acid.
| Compound Name | 2,3,4,5-tetrabromo-6-[(Z)-(4-hydroxy-3-sulfophenyl)-(4-oxo-3-sulfocyclohexa-2,5-dien-1-ylidene)methyl]benzoic acid |
|---|---|
| PubChem CID | 66509204 |
| Molecular Formula | C20H10Br4O10S2 |
| Molecular Weight | 794.04 g/mol |
| Exact Mass | 789.64 |
| IUPAC Name | 2,3,4,5-tetrabromo-6-[(Z)-(4-hydroxy-3-sulfophenyl)-(4-oxo-3-sulfocyclohexa-2,5-dien-1-ylidene)methyl]benzoic acid |
| SMILES | O=C1C=C/C(=C(\c2ccc(O)c(S(=O)(=O)O)c2)c2c(Br)c(Br)c(Br)c(Br)c2C(=O)O)C=C1S(=O)(=O)O |
| InChI | InChI=1S/C20H10Br4O10S2/c21-16-14(15(20(27)28)17(22)19(24)18(16)23)13(7-1-3-9(25)11(5-7)35(29,30)31)8-2-4-10(26)12(6-8)36(32,33)34/h1-6,25H,(H,27,28)(H,29,30,31)(H,32,33,34)/b13-8- |
| InChIKey | QXYLHATWIZSSFN-JYRVWZFOSA-N |
| XLogP | 5.10 |
| TPSA | 183.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.04 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|