C20H13Cl2O4S- — CID 59075360
2-[(E)-(3-chloro-4-methylphenyl)-(3-chloro-4-oxocyclohexa-2,5-dien-1-ylidene)methyl]benzenesulfonate (PubChem CID 59075360) has the molecular formula C20H13Cl2O4S- and a molecular weight of 420.29 g/mol. Its IUPAC name is 2-[(E)-(3-chloro-4-methylphenyl)-(3-chloro-4-oxocyclohexa-2,5-dien-1-ylidene)methyl]benzenesulfonate.
| Compound Name | 2-[(E)-(3-chloro-4-methylphenyl)-(3-chloro-4-oxocyclohexa-2,5-dien-1-ylidene)methyl]benzenesulfonate |
|---|---|
| PubChem CID | 59075360 |
| Molecular Formula | C20H13Cl2O4S- |
| Molecular Weight | 420.29 g/mol |
| Exact Mass | 418.99 |
| IUPAC Name | 2-[(E)-(3-chloro-4-methylphenyl)-(3-chloro-4-oxocyclohexa-2,5-dien-1-ylidene)methyl]benzenesulfonate |
| SMILES | Cc1ccc(/C(=C2/C=CC(=O)C(Cl)=C2)c2ccccc2S(=O)(=O)[O-])cc1Cl |
| InChI | InChI=1S/C20H14Cl2O4S/c1-12-6-7-13(10-16(12)21)20(14-8-9-18(23)17(22)11-14)15-4-2-3-5-19(15)27(24,25)26/h2-11H,1H3,(H,24,25,26)/p-1/b20-14+ |
| InChIKey | WKLDHCMJAYMAOI-XSFVSMFZSA-M |
| XLogP | 4.62 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.29 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|