C40H40Cl2N2O3S — CID 152796679
2-[[3-chloro-4-(2,3,4,6-tetramethylanilino)phenyl]-[3-chloro-4-(2,3,4,6-tetramethylphenyl)azaniumylidenecyclohexa-2,5-dien-1-ylidene]methyl]-5-methylbenzenesulfonate (PubChem CID 152796679) has the molecular formula C40H40Cl2N2O3S and a molecular weight of 699.74 g/mol. Its IUPAC name is 2-[[3-chloro-4-(2,3,4,6-tetramethylanilino)phenyl]-[3-chloro-4-(2,3,4,6-tetramethylphenyl)azaniumylidenecyclohexa-2,5-dien-1-ylidene]methyl]-5-methylbenzenesulfonate.
| Compound Name | 2-[[3-chloro-4-(2,3,4,6-tetramethylanilino)phenyl]-[3-chloro-4-(2,3,4,6-tetramethylphenyl)azaniumylidenecyclohexa-2,5-dien-1-ylidene]methyl]-5-methylbenzenesulfonate |
|---|---|
| PubChem CID | 152796679 |
| Molecular Formula | C40H40Cl2N2O3S |
| Molecular Weight | 699.74 g/mol |
| Exact Mass | 698.21 |
| IUPAC Name | 2-[[3-chloro-4-(2,3,4,6-tetramethylanilino)phenyl]-[3-chloro-4-(2,3,4,6-tetramethylphenyl)azaniumylidenecyclohexa-2,5-dien-1-ylidene]methyl]-5-methylbenzenesulfonate |
| SMILES | Cc1ccc(C(=C2C=C/C(=[NH+]\c3c(C)cc(C)c(C)c3C)C(Cl)=C2)c2ccc(Nc3c(C)cc(C)c(C)c3C)c(Cl)c2)c(S(=O)(=O)[O-])c1 |
| InChI | InChI=1S/C40H40Cl2N2O3S/c1-21-10-13-32(37(16-21)48(45,46)47)38(30-11-14-35(33(41)19-30)43-39-24(4)17-22(2)26(6)28(39)8)31-12-15-36(34(42)20-31)44-40-25(5)18-23(3)27(7)29(40)9/h10-20,43H,1-9H3,(H,45,46,47)/b38-31?,44-36+ |
| InChIKey | NZNUTFKOXQRPGV-JYPRQXSYSA-N |
| XLogP | 9.11 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.74 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|