C27H29O6S- — CID 159627486
2-acetyl-5-methylbenzenesulfonate;bis(1-(4-methylphenyl)ethanone) (PubChem CID 159627486) has the molecular formula C27H29O6S- and a molecular weight of 481.59 g/mol. Its IUPAC name is 2-acetyl-5-methylbenzenesulfonate;bis(1-(4-methylphenyl)ethanone).
| Compound Name | 2-acetyl-5-methylbenzenesulfonate;bis(1-(4-methylphenyl)ethanone) |
|---|---|
| PubChem CID | 159627486 |
| Molecular Formula | C27H29O6S- |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | 2-acetyl-5-methylbenzenesulfonate;bis(1-(4-methylphenyl)ethanone) |
| SMILES | CC(=O)c1ccc(C)cc1.CC(=O)c1ccc(C)cc1.CC(=O)c1ccc(C)cc1S(=O)(=O)[O-] |
| InChI | InChI=1S/C9H10O4S.2C9H10O/c1-6-3-4-8(7(2)10)9(5-6)14(11,12)13;2*1-7-3-5-9(6-4-7)8(2)10/h3-5H,1-2H3,(H,11,12,13);2*3-6H,1-2H3/p-1 |
| InChIKey | MORODMKNRHYKQV-UHFFFAOYSA-M |
| XLogP | 5.50 |
| TPSA | 108.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|