C13H13NO3S — CID 175600207
1-[5-(4-methylphenyl)sulfonyl-1H-pyrrol-3-yl]ethanone (PubChem CID 175600207) has the molecular formula C13H13NO3S and a molecular weight of 263.32 g/mol. Its IUPAC name is 1-[5-(4-methylphenyl)sulfonyl-1H-pyrrol-3-yl]ethanone.
| Compound Name | 1-[5-(4-methylphenyl)sulfonyl-1H-pyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 175600207 |
| Molecular Formula | C13H13NO3S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 1-[5-(4-methylphenyl)sulfonyl-1H-pyrrol-3-yl]ethanone |
| SMILES | CC(=O)c1c[nH]c(S(=O)(=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C13H13NO3S/c1-9-3-5-12(6-4-9)18(16,17)13-7-11(8-14-13)10(2)15/h3-8,14H,1-2H3 |
| InChIKey | VLEVUMFWZYWHKQ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 67.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |