C44H50N2O3S — CID 159803394
5-methyl-2-[[3-propan-2-yl-4-(2,4,6-trimethylanilino)phenyl]-[3-propan-2-yl-4-(2,4,6-trimethylphenyl)iminocyclohexa-2,5-dien-1-ylidene]methyl]benzenesulfonic acid (PubChem CID 159803394) has the molecular formula C44H50N2O3S and a molecular weight of 686.96 g/mol. Its IUPAC name is 5-methyl-2-[[3-propan-2-yl-4-(2,4,6-trimethylanilino)phenyl]-[3-propan-2-yl-4-(2,4,6-trimethylphenyl)iminocyclohexa-2,5-dien-1-ylidene]methyl]benzenesulfonic acid.
| Compound Name | 5-methyl-2-[[3-propan-2-yl-4-(2,4,6-trimethylanilino)phenyl]-[3-propan-2-yl-4-(2,4,6-trimethylphenyl)iminocyclohexa-2,5-dien-1-ylidene]methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 159803394 |
| Molecular Formula | C44H50N2O3S |
| Molecular Weight | 686.96 g/mol |
| Exact Mass | 686.35 |
| IUPAC Name | 5-methyl-2-[[3-propan-2-yl-4-(2,4,6-trimethylanilino)phenyl]-[3-propan-2-yl-4-(2,4,6-trimethylphenyl)iminocyclohexa-2,5-dien-1-ylidene]methyl]benzenesulfonic acid |
| SMILES | Cc1cc(C)c(/N=C2\C=CC(=C(c3ccc(Nc4c(C)cc(C)cc4C)c(C(C)C)c3)c3ccc(C)cc3S(=O)(=O)O)C=C2C(C)C)c(C)c1 |
| InChI | InChI=1S/C44H50N2O3S/c1-25(2)37-23-34(13-16-39(37)45-43-30(8)18-28(6)19-31(43)9)42(36-15-12-27(5)22-41(36)50(47,48)49)35-14-17-40(38(24-35)26(3)4)46-44-32(10)20-29(7)21-33(44)11/h12-26,45H,1-11H3,(H,47,48,49)/b42-35?,46-40+ |
| InChIKey | GQFNFNLZYVJVLS-YIXAYGBOSA-N |
| XLogP | 11.69 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.96 |
| LogP ≤ 5 | 11.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|