C39H40N2O9S3 — CID 146163096
4-[4-[[4-(2,6-dimethyl-4-sulfophenyl)imino-3,5-dimethylcyclohexa-2,5-dien-1-ylidene]-(2-sulfophenyl)methyl]-2,6-dimethylanilino]-3,5-dimethylbenzenesulfonic acid (PubChem CID 146163096) has the molecular formula C39H40N2O9S3 and a molecular weight of 776.96 g/mol. Its IUPAC name is 4-[4-[[4-(2,6-dimethyl-4-sulfophenyl)imino-3,5-dimethylcyclohexa-2,5-dien-1-ylidene]-(2-sulfophenyl)methyl]-2,6-dimethylanilino]-3,5-dimethylbenzenesulfonic acid.
| Compound Name | 4-[4-[[4-(2,6-dimethyl-4-sulfophenyl)imino-3,5-dimethylcyclohexa-2,5-dien-1-ylidene]-(2-sulfophenyl)methyl]-2,6-dimethylanilino]-3,5-dimethylbenzenesulfonic acid |
|---|---|
| PubChem CID | 146163096 |
| Molecular Formula | C39H40N2O9S3 |
| Molecular Weight | 776.96 g/mol |
| Exact Mass | 776.19 |
| IUPAC Name | 4-[4-[[4-(2,6-dimethyl-4-sulfophenyl)imino-3,5-dimethylcyclohexa-2,5-dien-1-ylidene]-(2-sulfophenyl)methyl]-2,6-dimethylanilino]-3,5-dimethylbenzenesulfonic acid |
| SMILES | CC1=CC(=C(c2cc(C)c(Nc3c(C)cc(S(=O)(=O)O)cc3C)c(C)c2)c2ccccc2S(=O)(=O)O)C=C(C)C1=Nc1c(C)cc(S(=O)(=O)O)cc1C |
| InChI | InChI=1S/C39H40N2O9S3/c1-21-13-29(14-22(2)36(21)40-38-25(5)17-31(18-26(38)6)51(42,43)44)35(33-11-9-10-12-34(33)53(48,49)50)30-15-23(3)37(24(4)16-30)41-39-27(7)19-32(20-28(39)8)52(45,46)47/h9-20,40H,1-8H3,(H,42,43,44)(H,45,46,47)(H,48,49,50)/b35-30-,41-37- |
| InChIKey | DAZSRVQTIXCRQI-IORDTSFMSA-N |
| XLogP | 8.50 |
| TPSA | 187.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.96 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|