C25H27N2NaO6S2 — CID 164512253
sodium;4-[[4-(ethylamino)-3-methylphenyl]-(4-ethylimino-3-methylcyclohexa-2,5-dien-1-ylidene)methyl]benzene-1,3-disulfonate;hydron (PubChem CID 164512253) has the molecular formula C25H27N2NaO6S2 and a molecular weight of 538.62 g/mol. Its IUPAC name is sodium;4-[[4-(ethylamino)-3-methylphenyl]-(4-ethylimino-3-methylcyclohexa-2,5-dien-1-ylidene)methyl]benzene-1,3-disulfonate;hydron.
| Compound Name | sodium;4-[[4-(ethylamino)-3-methylphenyl]-(4-ethylimino-3-methylcyclohexa-2,5-dien-1-ylidene)methyl]benzene-1,3-disulfonate;hydron |
|---|---|
| PubChem CID | 164512253 |
| Molecular Formula | C25H27N2NaO6S2 |
| Molecular Weight | 538.62 g/mol |
| Exact Mass | 538.12 |
| IUPAC Name | sodium;4-[[4-(ethylamino)-3-methylphenyl]-(4-ethylimino-3-methylcyclohexa-2,5-dien-1-ylidene)methyl]benzene-1,3-disulfonate;hydron |
| SMILES | CC/N=C1\C=CC(=C(c2ccc(NCC)c(C)c2)c2ccc(S(=O)(=O)[O-])cc2S(=O)(=O)[O-])C=C1C.[H+].[Na+] |
| InChI | InChI=1S/C25H28N2O6S2.Na/c1-5-26-22-11-7-18(13-16(22)3)25(19-8-12-23(27-6-2)17(4)14-19)21-10-9-20(34(28,29)30)15-24(21)35(31,32)33;/h7-15,26H,5-6H2,1-4H3,(H,28,29,30)(H,31,32,33);/q;+1/p-1/b25-19?,27-23+; |
| InChIKey | VVLFAAMTGMGYBS-PKWDQEIVSA-M |
| XLogP | 1.13 |
| TPSA | 138.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.62 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|