C27H44O2 — CID 139603513
(1S,9S,10R,13R,14R,17R)-17-[(2R,5R)-5-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-1-ol (PubChem CID 139603513) has the molecular formula C27H44O2 and a molecular weight of 400.65 g/mol. Its IUPAC name is (1S,9S,10R,13R,14R,17R)-17-[(2R,5R)-5-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-1-ol.
| Compound Name | (1S,9S,10R,13R,14R,17R)-17-[(2R,5R)-5-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-1-ol |
|---|---|
| PubChem CID | 139603513 |
| Molecular Formula | C27H44O2 |
| Molecular Weight | 400.65 g/mol |
| Exact Mass | 400.33 |
| IUPAC Name | (1S,9S,10R,13R,14R,17R)-17-[(2R,5R)-5-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-1-ol |
| SMILES | CC(C)[C@H](O)CC[C@@H](C)[C@H]1CC[C@H]2C3=CC=C4CCC[C@H](O)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H44O2/c1-17(2)24(28)14-9-18(3)21-12-13-22-20-11-10-19-7-6-8-25(29)27(19,5)23(20)15-16-26(21,22)4/h10-11,17-18,21-25,28-29H,6-9,12-16H2,1-5H3/t18-,21-,22+,23+,24-,25+,26-,27+/m1/s1 |
| InChIKey | AONGRGSPPFICCR-ZRNNVOQVSA-N |
| XLogP | 6.28 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.65 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |