C35H43F3N2O4 — CID 139608281
[(2R)-1,1,1-trifluorodecan-2-yl] 4-[4-(5-hexylpyrimidin-2-yl)benzoyl]oxy-2-methylbenzoate (PubChem CID 139608281) has the molecular formula C35H43F3N2O4 and a molecular weight of 612.73 g/mol. Its IUPAC name is [(2R)-1,1,1-trifluorodecan-2-yl] 4-[4-(5-hexylpyrimidin-2-yl)benzoyl]oxy-2-methylbenzoate.
| Compound Name | [(2R)-1,1,1-trifluorodecan-2-yl] 4-[4-(5-hexylpyrimidin-2-yl)benzoyl]oxy-2-methylbenzoate |
|---|---|
| PubChem CID | 139608281 |
| Molecular Formula | C35H43F3N2O4 |
| Molecular Weight | 612.73 g/mol |
| Exact Mass | 612.32 |
| IUPAC Name | [(2R)-1,1,1-trifluorodecan-2-yl] 4-[4-(5-hexylpyrimidin-2-yl)benzoyl]oxy-2-methylbenzoate |
| SMILES | CCCCCCCC[C@@H](OC(=O)c1ccc(OC(=O)c2ccc(-c3ncc(CCCCCC)cn3)cc2)cc1C)C(F)(F)F |
| InChI | InChI=1S/C35H43F3N2O4/c1-4-6-8-10-11-13-15-31(35(36,37)38)44-34(42)30-21-20-29(22-25(30)3)43-33(41)28-18-16-27(17-19-28)32-39-23-26(24-40-32)14-12-9-7-5-2/h16-24,31H,4-15H2,1-3H3/t31-/m1/s1 |
| InChIKey | KOJYHOSKAWHDHZ-WJOKGBTCSA-N |
| XLogP | 9.63 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.73 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|