C24H28O2S — CID 139608727
3-benzyl-4-(4-methoxy-3-methyl-2-phenylsulfanylbut-3-en-2-yl)cyclopentan-1-one (PubChem CID 139608727) has the molecular formula C24H28O2S and a molecular weight of 380.55 g/mol. Its IUPAC name is 3-benzyl-4-(4-methoxy-3-methyl-2-phenylsulfanylbut-3-en-2-yl)cyclopentan-1-one.
| Compound Name | 3-benzyl-4-(4-methoxy-3-methyl-2-phenylsulfanylbut-3-en-2-yl)cyclopentan-1-one |
|---|---|
| PubChem CID | 139608727 |
| Molecular Formula | C24H28O2S |
| Molecular Weight | 380.55 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 3-benzyl-4-(4-methoxy-3-methyl-2-phenylsulfanylbut-3-en-2-yl)cyclopentan-1-one |
| SMILES | COC=C(C)C(C)(Sc1ccccc1)C1CC(=O)CC1Cc1ccccc1 |
| InChI | InChI=1S/C24H28O2S/c1-18(17-26-3)24(2,27-22-12-8-5-9-13-22)23-16-21(25)15-20(23)14-19-10-6-4-7-11-19/h4-13,17,20,23H,14-16H2,1-3H3 |
| InChIKey | IBBMLWFQKOXSFV-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.55 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|