About 2-hexyl-4-nitrosophenol
2-hexyl-4-nitrosophenol (PubChem CID 139609706) has the molecular formula C12H17NO2
and a molecular weight of 207.27 g/mol. Its IUPAC name is 2-hexyl-4-nitrosophenol.
Molecular Properties
| Compound Name | 2-hexyl-4-nitrosophenol |
| PubChem CID | 139609706 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 2-hexyl-4-nitrosophenol |
| SMILES | CCCCCCc1cc(N=O)ccc1O |
| InChI | InChI=1S/C12H17NO2/c1-2-3-4-5-6-10-9-11(13-15)7-8-12(10)14/h7-9,14H,2-6H2,1H3 |
| InChIKey | PZKYFRYNKVGYLH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-hexyl-4-nitrosophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hexyl-4-nitrosophenol?
The IUPAC name of 2-hexyl-4-nitrosophenol (CID 139609706) is 2-hexyl-4-nitrosophenol.
What is the SMILES notation for 2-hexyl-4-nitrosophenol?
The canonical SMILES for 2-hexyl-4-nitrosophenol is CCCCCCc1cc(N=O)ccc1O.
What is the InChIKey of 2-hexyl-4-nitrosophenol?
The InChIKey is PZKYFRYNKVGYLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO2/c1-2-3-4-5-6-10-9-11(13-15)7-8-12(10)14/h7-9,14H,2-6H2,1H3.
What are the key properties of 2-hexyl-4-nitrosophenol?
2-hexyl-4-nitrosophenol has a molecular weight of 207.27 g/mol, XLogP of 3.91, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hexyl-4-nitrosophenol is sourced from PubChem (CID 139609706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).