About 4-nitroso-2-pentylphenol
4-nitroso-2-pentylphenol (PubChem CID 88799968) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is 4-nitroso-2-pentylphenol.
Molecular Properties
| Compound Name | 4-nitroso-2-pentylphenol |
| PubChem CID | 88799968 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 4-nitroso-2-pentylphenol |
| SMILES | CCCCCc1cc(N=O)ccc1O |
| InChI | InChI=1S/C11H15NO2/c1-2-3-4-5-9-8-10(12-14)6-7-11(9)13/h6-8,13H,2-5H2,1H3 |
| InChIKey | FYDSLUOPKBXEIU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-nitroso-2-pentylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitroso-2-pentylphenol?
The IUPAC name of 4-nitroso-2-pentylphenol (CID 88799968) is 4-nitroso-2-pentylphenol.
What is the SMILES notation for 4-nitroso-2-pentylphenol?
The canonical SMILES for 4-nitroso-2-pentylphenol is CCCCCc1cc(N=O)ccc1O.
What is the InChIKey of 4-nitroso-2-pentylphenol?
The InChIKey is FYDSLUOPKBXEIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2/c1-2-3-4-5-9-8-10(12-14)6-7-11(9)13/h6-8,13H,2-5H2,1H3.
What are the key properties of 4-nitroso-2-pentylphenol?
4-nitroso-2-pentylphenol has a molecular weight of 193.25 g/mol, XLogP of 3.52, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitroso-2-pentylphenol is sourced from PubChem (CID 88799968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).