About 2-nitroso-3-pentylphenol
2-nitroso-3-pentylphenol (PubChem CID 174862655) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is 2-nitroso-3-pentylphenol.
Molecular Properties
| Compound Name | 2-nitroso-3-pentylphenol |
| PubChem CID | 174862655 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 2-nitroso-3-pentylphenol |
| SMILES | CCCCCc1cccc(O)c1N=O |
| InChI | InChI=1S/C11H15NO2/c1-2-3-4-6-9-7-5-8-10(13)11(9)12-14/h5,7-8,13H,2-4,6H2,1H3 |
| InChIKey | OEDRMCBUIOOSAS-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-nitroso-3-pentylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitroso-3-pentylphenol?
The IUPAC name of 2-nitroso-3-pentylphenol (CID 174862655) is 2-nitroso-3-pentylphenol.
What is the SMILES notation for 2-nitroso-3-pentylphenol?
The canonical SMILES for 2-nitroso-3-pentylphenol is CCCCCc1cccc(O)c1N=O.
What is the InChIKey of 2-nitroso-3-pentylphenol?
The InChIKey is OEDRMCBUIOOSAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2/c1-2-3-4-6-9-7-5-8-10(13)11(9)12-14/h5,7-8,13H,2-4,6H2,1H3.
What are the key properties of 2-nitroso-3-pentylphenol?
2-nitroso-3-pentylphenol has a molecular weight of 193.25 g/mol, XLogP of 3.52, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitroso-3-pentylphenol is sourced from PubChem (CID 174862655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).