C22H25NO5 — CID 139610639
methyl 4-[(E)-methoxyiminomethyl]-5,5-bis(4-methoxyphenyl)pent-4-enoate (PubChem CID 139610639) has the molecular formula C22H25NO5 and a molecular weight of 383.44 g/mol. Its IUPAC name is methyl 4-[(E)-methoxyiminomethyl]-5,5-bis(4-methoxyphenyl)pent-4-enoate.
| Compound Name | methyl 4-[(E)-methoxyiminomethyl]-5,5-bis(4-methoxyphenyl)pent-4-enoate |
|---|---|
| PubChem CID | 139610639 |
| Molecular Formula | C22H25NO5 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | methyl 4-[(E)-methoxyiminomethyl]-5,5-bis(4-methoxyphenyl)pent-4-enoate |
| SMILES | CO/N=C/C(CCC(=O)OC)=C(c1ccc(OC)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H25NO5/c1-25-19-10-5-16(6-11-19)22(17-7-12-20(26-2)13-8-17)18(15-23-28-4)9-14-21(24)27-3/h5-8,10-13,15H,9,14H2,1-4H3/b23-15+ |
| InChIKey | BQTZPCVPQPTHNN-HZHRSRAPSA-N |
| XLogP | 4.09 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|