C23H27NO5 — CID 139610660
methyl 6-(hydroxyiminomethyl)-7,7-bis(4-methoxyphenyl)hept-6-enoate (PubChem CID 139610660) has the molecular formula C23H27NO5 and a molecular weight of 397.47 g/mol. Its IUPAC name is methyl 6-(hydroxyiminomethyl)-7,7-bis(4-methoxyphenyl)hept-6-enoate.
| Compound Name | methyl 6-(hydroxyiminomethyl)-7,7-bis(4-methoxyphenyl)hept-6-enoate |
|---|---|
| PubChem CID | 139610660 |
| Molecular Formula | C23H27NO5 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | methyl 6-(hydroxyiminomethyl)-7,7-bis(4-methoxyphenyl)hept-6-enoate |
| SMILES | COC(=O)CCCCC(C=NO)=C(c1ccc(OC)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C23H27NO5/c1-27-20-12-8-17(9-13-20)23(18-10-14-21(28-2)15-11-18)19(16-24-26)6-4-5-7-22(25)29-3/h8-16,26H,4-7H2,1-3H3 |
| InChIKey | LQUGLQHXLDLAAQ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|