C10H15N3O4 — CID 139615178
methyl (5S,8S)-7-ethyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonane-8-carboxylate (PubChem CID 139615178) has the molecular formula C10H15N3O4 and a molecular weight of 241.25 g/mol. Its IUPAC name is methyl (5S,8S)-7-ethyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonane-8-carboxylate.
| Compound Name | methyl (5S,8S)-7-ethyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonane-8-carboxylate |
|---|---|
| PubChem CID | 139615178 |
| Molecular Formula | C10H15N3O4 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | methyl (5S,8S)-7-ethyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonane-8-carboxylate |
| SMILES | CCN1C[C@]2(C[C@H]1C(=O)OC)NC(=O)NC2=O |
| InChI | InChI=1S/C10H15N3O4/c1-3-13-5-10(4-6(13)7(14)17-2)8(15)11-9(16)12-10/h6H,3-5H2,1-2H3,(H2,11,12,15,16)/t6-,10-/m0/s1 |
| InChIKey | OSQFLOSVNMXHQO-WKEGUHRASA-N |
| XLogP | -1.17 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|