C17H25BO4 — CID 139617313
5-methoxy-2-[4-(4-methoxycyclohexyl)phenyl]-1,3,2-dioxaborinane (PubChem CID 139617313) has the molecular formula C17H25BO4 and a molecular weight of 304.20 g/mol. Its IUPAC name is 5-methoxy-2-[4-(4-methoxycyclohexyl)phenyl]-1,3,2-dioxaborinane.
| Compound Name | 5-methoxy-2-[4-(4-methoxycyclohexyl)phenyl]-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 139617313 |
| Molecular Formula | C17H25BO4 |
| Molecular Weight | 304.20 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 5-methoxy-2-[4-(4-methoxycyclohexyl)phenyl]-1,3,2-dioxaborinane |
| SMILES | COC1CCC(c2ccc(B3OCC(OC)CO3)cc2)CC1 |
| InChI | InChI=1S/C17H25BO4/c1-19-16-9-5-14(6-10-16)13-3-7-15(8-4-13)18-21-11-17(20-2)12-22-18/h3-4,7-8,14,16-17H,5-6,9-12H2,1-2H3 |
| InChIKey | ZNGKKDKISUMJEH-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.20 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|