C23H32N4O3S — CID 139617812
3-(2,2-dimethoxyethyl)-1-[4-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-1-methylthiourea (PubChem CID 139617812) has the molecular formula C23H32N4O3S and a molecular weight of 444.60 g/mol. Its IUPAC name is 3-(2,2-dimethoxyethyl)-1-[4-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-1-methylthiourea.
| Compound Name | 3-(2,2-dimethoxyethyl)-1-[4-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-1-methylthiourea |
|---|---|
| PubChem CID | 139617812 |
| Molecular Formula | C23H32N4O3S |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 3-(2,2-dimethoxyethyl)-1-[4-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-1-methylthiourea |
| SMILES | COc1ccc(N2CCN(c3ccc(N(C)C(=S)NCC(OC)OC)cc3)CC2)cc1 |
| InChI | InChI=1S/C23H32N4O3S/c1-25(23(31)24-17-22(29-3)30-4)18-5-7-19(8-6-18)26-13-15-27(16-14-26)20-9-11-21(28-2)12-10-20/h5-12,22H,13-17H2,1-4H3,(H,24,31) |
| InChIKey | KACFXKFRQZZSOE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 49.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|