About piperidin-1-ium;N-piperidin-1-ylcarbamate
piperidin-1-ium;N-piperidin-1-ylcarbamate (PubChem CID 139618603) has the molecular formula C11H23N3O2
and a molecular weight of 229.32 g/mol. Its IUPAC name is piperidin-1-ium;N-piperidin-1-ylcarbamate.
Molecular Properties
| Compound Name | piperidin-1-ium;N-piperidin-1-ylcarbamate |
| PubChem CID | 139618603 |
| Molecular Formula | C11H23N3O2 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | piperidin-1-ium;N-piperidin-1-ylcarbamate |
| SMILES | C1CC[NH2+]CC1.O=C([O-])NN1CCCCC1 |
| InChI | InChI=1S/C6H12N2O2.C5H11N/c9-6(10)7-8-4-2-1-3-5-8;1-2-4-6-5-3-1/h7H,1-5H2,(H,9,10);6H,1-5H2 |
| InChIKey | YLTMDZPHHLQWRW-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 72.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze piperidin-1-ium;N-piperidin-1-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidin-1-ium;N-piperidin-1-ylcarbamate?
The IUPAC name of piperidin-1-ium;N-piperidin-1-ylcarbamate (CID 139618603) is piperidin-1-ium;N-piperidin-1-ylcarbamate.
What is the SMILES notation for piperidin-1-ium;N-piperidin-1-ylcarbamate?
The canonical SMILES for piperidin-1-ium;N-piperidin-1-ylcarbamate is C1CC[NH2+]CC1.O=C([O-])NN1CCCCC1.
What is the InChIKey of piperidin-1-ium;N-piperidin-1-ylcarbamate?
The InChIKey is YLTMDZPHHLQWRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O2.C5H11N/c9-6(10)7-8-4-2-1-3-5-8;1-2-4-6-5-3-1/h7H,1-5H2,(H,9,10);6H,1-5H2.
What are the key properties of piperidin-1-ium;N-piperidin-1-ylcarbamate?
piperidin-1-ium;N-piperidin-1-ylcarbamate has a molecular weight of 229.32 g/mol, XLogP of -0.95, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-1-ium;N-piperidin-1-ylcarbamate is sourced from PubChem (CID 139618603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).