About piperidine;piperidin-1-ium;carbamate
piperidine;piperidin-1-ium;carbamate (PubChem CID 19375390) has the molecular formula C11H25N3O2
and a molecular weight of 231.34 g/mol. Its IUPAC name is piperidine;piperidin-1-ium;carbamate.
Molecular Properties
| Compound Name | piperidine;piperidin-1-ium;carbamate |
| PubChem CID | 19375390 |
| Molecular Formula | C11H25N3O2 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.19 |
| IUPAC Name | piperidine;piperidin-1-ium;carbamate |
| SMILES | C1CCNCC1.C1CC[NH2+]CC1.NC(=O)[O-] |
| InChI | InChI=1S/2C5H11N.CH3NO2/c2*1-2-4-6-5-3-1;2-1(3)4/h2*6H,1-5H2;2H2,(H,3,4) |
| InChIKey | UATLOUQSFSSQMH-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 94.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze piperidine;piperidin-1-ium;carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidine;piperidin-1-ium;carbamate?
The IUPAC name of piperidine;piperidin-1-ium;carbamate (CID 19375390) is piperidine;piperidin-1-ium;carbamate.
What is the SMILES notation for piperidine;piperidin-1-ium;carbamate?
The canonical SMILES for piperidine;piperidin-1-ium;carbamate is C1CCNCC1.C1CC[NH2+]CC1.NC(=O)[O-].
What is the InChIKey of piperidine;piperidin-1-ium;carbamate?
The InChIKey is UATLOUQSFSSQMH-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H11N.CH3NO2/c2*1-2-4-6-5-3-1;2-1(3)4/h2*6H,1-5H2;2H2,(H,3,4).
What are the key properties of piperidine;piperidin-1-ium;carbamate?
piperidine;piperidin-1-ium;carbamate has a molecular weight of 231.34 g/mol, XLogP of -1.22, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for piperidine;piperidin-1-ium;carbamate is sourced from PubChem (CID 19375390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).