About bis(piperidin-1-ium);carbonate
bis(piperidin-1-ium);carbonate (PubChem CID 69100409) has the molecular formula C11H24N2O3
and a molecular weight of 232.32 g/mol. Its IUPAC name is bis(piperidin-1-ium);carbonate.
Molecular Properties
| Compound Name | bis(piperidin-1-ium);carbonate |
| PubChem CID | 69100409 |
| Molecular Formula | C11H24N2O3 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | bis(piperidin-1-ium);carbonate |
| SMILES | C1CC[NH2+]CC1.C1CC[NH2+]CC1.O=C([O-])[O-] |
| InChI | InChI=1S/2C5H11N.CH2O3/c2*1-2-4-6-5-3-1;2-1(3)4/h2*6H,1-5H2;(H2,2,3,4) |
| InChIKey | IFPXXGWGVJNEJB-UHFFFAOYSA-N |
| XLogP | -2.98 |
| TPSA | 96.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | -2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze bis(piperidin-1-ium);carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(piperidin-1-ium);carbonate?
The IUPAC name of bis(piperidin-1-ium);carbonate (CID 69100409) is bis(piperidin-1-ium);carbonate.
What is the SMILES notation for bis(piperidin-1-ium);carbonate?
The canonical SMILES for bis(piperidin-1-ium);carbonate is C1CC[NH2+]CC1.C1CC[NH2+]CC1.O=C([O-])[O-].
What is the InChIKey of bis(piperidin-1-ium);carbonate?
The InChIKey is IFPXXGWGVJNEJB-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H11N.CH2O3/c2*1-2-4-6-5-3-1;2-1(3)4/h2*6H,1-5H2;(H2,2,3,4).
What are the key properties of bis(piperidin-1-ium);carbonate?
bis(piperidin-1-ium);carbonate has a molecular weight of 232.32 g/mol, XLogP of -2.98, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(piperidin-1-ium);carbonate is sourced from PubChem (CID 69100409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).