C28H30N2O5 — CID 139618755
methyl 2-[[(2R,3R)-2,3-dibenzyl-4-oxo-4-(phenylmethoxyamino)butanoyl]amino]acetate (PubChem CID 139618755) has the molecular formula C28H30N2O5 and a molecular weight of 474.56 g/mol. Its IUPAC name is methyl 2-[[(2R,3R)-2,3-dibenzyl-4-oxo-4-(phenylmethoxyamino)butanoyl]amino]acetate.
| Compound Name | methyl 2-[[(2R,3R)-2,3-dibenzyl-4-oxo-4-(phenylmethoxyamino)butanoyl]amino]acetate |
|---|---|
| PubChem CID | 139618755 |
| Molecular Formula | C28H30N2O5 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | methyl 2-[[(2R,3R)-2,3-dibenzyl-4-oxo-4-(phenylmethoxyamino)butanoyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)[C@H](Cc1ccccc1)[C@@H](Cc1ccccc1)C(=O)NOCc1ccccc1 |
| InChI | InChI=1S/C28H30N2O5/c1-34-26(31)19-29-27(32)24(17-21-11-5-2-6-12-21)25(18-22-13-7-3-8-14-22)28(33)30-35-20-23-15-9-4-10-16-23/h2-16,24-25H,17-20H2,1H3,(H,29,32)(H,30,33)/t24-,25-/m1/s1 |
| InChIKey | GATHYYLCOXXEPW-JWQCQUIFSA-N |
| XLogP | 3.24 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|