C21H27KO3S — CID 139619690
potassium bis(2-butylphenyl)methanesulfonate (PubChem CID 139619690) has the molecular formula C21H27KO3S and a molecular weight of 398.61 g/mol. Its IUPAC name is potassium bis(2-butylphenyl)methanesulfonate.
| Compound Name | potassium bis(2-butylphenyl)methanesulfonate |
|---|---|
| PubChem CID | 139619690 |
| Molecular Formula | C21H27KO3S |
| Molecular Weight | 398.61 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | potassium bis(2-butylphenyl)methanesulfonate |
| SMILES | CCCCc1ccccc1C(c1ccccc1CCCC)S(=O)(=O)[O-].[K+] |
| InChI | InChI=1S/C21H28O3S.K/c1-3-5-11-17-13-7-9-15-19(17)21(25(22,23)24)20-16-10-8-14-18(20)12-6-4-2;/h7-10,13-16,21H,3-6,11-12H2,1-2H3,(H,22,23,24);/q;+1/p-1 |
| InChIKey | KINRDNHWVNHGPS-UHFFFAOYSA-M |
| XLogP | 2.01 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.61 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|