About CID 66774119
CID 66774119 (PubChem CID 66774119) has the molecular formula C14H21OSi
and a molecular weight of 233.41 g/mol.
Molecular Properties
| Compound Name | CID 66774119 |
| PubChem CID | 66774119 |
| Molecular Formula | C14H21OSi |
| Molecular Weight | 233.41 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | — |
| SMILES | CCCCc1ccccc1C(CCC)O[Si] |
| InChI | InChI=1S/C14H21OSi/c1-3-5-9-12-10-6-7-11-13(12)14(15-16)8-4-2/h6-7,10-11,14H,3-5,8-9H2,1-2H3 |
| InChIKey | DKNQQLDEUQYZGI-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.41 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 66774119 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 66774119?
The IUPAC name of CID 66774119 (CID 66774119) is not available.
What is the SMILES notation for CID 66774119?
The canonical SMILES for CID 66774119 is CCCCc1ccccc1C(CCC)O[Si].
What is the InChIKey of CID 66774119?
The InChIKey is DKNQQLDEUQYZGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21OSi/c1-3-5-9-12-10-6-7-11-13(12)14(15-16)8-4-2/h6-7,10-11,14H,3-5,8-9H2,1-2H3.
What are the key properties of CID 66774119?
CID 66774119 has a molecular weight of 233.41 g/mol, XLogP of 3.97, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 66774119 is sourced from PubChem (CID 66774119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).