C14H14Cl2N2O2 — CID 139622058
N-(2-cyanopropan-2-yl)-3-(2,4-dichlorophenoxy)but-2-enamide (PubChem CID 139622058) has the molecular formula C14H14Cl2N2O2 and a molecular weight of 313.18 g/mol. Its IUPAC name is N-(2-cyanopropan-2-yl)-3-(2,4-dichlorophenoxy)but-2-enamide.
| Compound Name | N-(2-cyanopropan-2-yl)-3-(2,4-dichlorophenoxy)but-2-enamide |
|---|---|
| PubChem CID | 139622058 |
| Molecular Formula | C14H14Cl2N2O2 |
| Molecular Weight | 313.18 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | N-(2-cyanopropan-2-yl)-3-(2,4-dichlorophenoxy)but-2-enamide |
| SMILES | CC(=CC(=O)NC(C)(C)C#N)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H14Cl2N2O2/c1-9(6-13(19)18-14(2,3)8-17)20-12-5-4-10(15)7-11(12)16/h4-7H,1-3H3,(H,18,19) |
| InChIKey | CHMSLIAZRBUBFD-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.18 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|