C13H13Cl3O — CID 54326244
2,4-dichloro-1-(1-chloro-3,3-dimethylpenta-1,4-dien-2-yl)oxybenzene (PubChem CID 54326244) has the molecular formula C13H13Cl3O and a molecular weight of 291.61 g/mol. Its IUPAC name is 2,4-dichloro-1-(1-chloro-3,3-dimethylpenta-1,4-dien-2-yl)oxybenzene.
| Compound Name | 2,4-dichloro-1-(1-chloro-3,3-dimethylpenta-1,4-dien-2-yl)oxybenzene |
|---|---|
| PubChem CID | 54326244 |
| Molecular Formula | C13H13Cl3O |
| Molecular Weight | 291.61 g/mol |
| Exact Mass | 290.00 |
| IUPAC Name | 2,4-dichloro-1-(1-chloro-3,3-dimethylpenta-1,4-dien-2-yl)oxybenzene |
| SMILES | C=CC(C)(C)C(=CCl)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H13Cl3O/c1-4-13(2,3)12(8-14)17-11-6-5-9(15)7-10(11)16/h4-8H,1H2,2-3H3 |
| InChIKey | SVDDIDYONARMDB-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.61 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|